Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> tert-butyl 4-aMino-4-(trifluoroMethyl)piperidine-1-carboxylate hydrochloride
For research use only. Not for therapeutic Use.
Tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate hydrochloride(Cat No.:L018169), is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidine derivative containing a tert-butyl group, an amino group, and a trifluoromethyl group attached to different positions of the piperidine ring. The hydrochloride form is a common salt used for stability and handling purposes. This compound serves as a valuable intermediate in synthesizing various organic molecules and pharmaceutical agents. Its unique structure makes it suitable for introducing specific functional groups into target molecules.
Catalog Number | L018169 |
CAS Number | 1402047-77-1 |
Molecular Formula | C11H20ClF3N2O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate;hydrochloride |
InChI | InChI=1S/C11H19F3N2O2.ClH/c1-9(2,3)18-8(17)16-6-4-10(15,5-7-16)11(12,13)14;/h4-7,15H2,1-3H3;1H |
InChIKey | ZFIAHPZJJRVMJZ-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(F)(F)F)N.Cl |