For research use only. Not for therapeutic Use.
Tert-butyl 4-bromo-1H-imidazole-1-carboxylate(Cat No.:L007221), is a chemical compound. It consists of an imidazole ring—a five-membered heterocyclic compound—substituted with a tert-butyl group at the nitrogen atom and a bromo and carboxylate group at specific positions. This compound is important in medicinal chemistry and drug discovery research, often serving as a key intermediate in the synthesis of complex organic molecules. Its unique structure makes it valuable for designing potential pharmaceuticals. Researchers utilize tert-butyl 4-bromo-1H-imidazole-1-carboxylate as a building block for the creation of diverse bioactive compounds, contributing to drug discovery efforts and advancements in medicinal chemistry research.
CAS Number | 1338257-80-9 |
Molecular Formula | C8H11BrN2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-bromoimidazole-1-carboxylate |
InChI | InChI=1S/C8H11BrN2O2/c1-8(2,3)13-7(12)11-4-6(9)10-5-11/h4-5H,1-3H3 |
InChIKey | VLWNHKQNLFMFBL-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1C=C(N=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |