Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> Tert-butyl 4-(bromomethyl)-4-fluoropiperidine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 4-(bromomethyl)-4-fluoropiperidine-1-carboxylate (Cat No.:L028225) is an organic compound with a piperidine ring substituted by a bromomethyl group and a fluorine atom at position 4. The name indicates a tert-butyl ester at the carboxylate position. This compound finds applications in pharmaceutical research and chemical synthesis. Its unique structure suggests potential bioactivity and the tert-butyl ester protects the carboxylic acid functionality during reactions. The presence of both bromine and fluorine substituents offers opportunities for further chemical modifications, making it valuable in medicinal chemistry for designing bioactive molecules and synthetic intermediates.
CAS Number | 1207176-24-6 |
Molecular Formula | C11H19BrFNO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | tert-butyl 4-(bromomethyl)-4-fluoropiperidine-1-carboxylate |
InChI | InChI=1S/C11H19BrFNO2/c1-10(2,3)16-9(15)14-6-4-11(13,8-12)5-7-14/h4-8H2,1-3H3 |
InChIKey | USTMSYLQMJWLAB-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CBr)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |