For research use only. Not for therapeutic Use.
tert-Butyl (4-iodocyclohexyl)carbamate(Cat No.:L029633)is a carbamate-protected amine featuring an iodine-substituted cyclohexyl group. This compound is widely used in pharmaceutical research and organic synthesis as a building block for the development of bioactive molecules, including drug candidates. The tert-butyl carbamate (Boc) group offers protection during synthetic processes, allowing for selective reactions and further functionalization. The iodine atom provides a handle for cross-coupling reactions, making this compound valuable in creating complex molecular structures. Its high purity and stability ensure consistent results in advanced research applications.
CAS Number | 1179986-79-8 |
Molecular Formula | C11H20INO2 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-(4-iodocyclohexyl)carbamate |
InChI | InChI=1S/C11H20INO2/c1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9/h8-9H,4-7H2,1-3H3,(H,13,14) |
InChIKey | QCZCZCVQESKMBB-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |