Home
>
Chemical Reagents>Heterocyclic Building Blocks> Tert-butyl 4-(prop-2-yn-1-yloxy)piperidine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 4-(prop-2-yn-1-yloxy)piperidine-1-carboxylate(Cat No.:L007823), is a chemical compound widely employed in research and development. Its molecular structure comprises a piperidine ring substituted with a tert-butyl ester group at one end and a prop-2-yn-1-yloxy group at the other end. This compound is utilized as a valuable building block in the synthesis of various organic molecules, including pharmaceuticals and agrochemicals. Scientists and chemists leverage its unique reactivity and versatility to create complex structures for diverse applications, making it a vital component in modern organic synthesis strategies.
CAS Number | 1219827-56-1 |
Molecular Formula | C13H21NO3 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-prop-2-ynoxypiperidine-1-carboxylate |
InChI | InChI=1S/C13H21NO3/c1-5-10-16-11-6-8-14(9-7-11)12(15)17-13(2,3)4/h1,11H,6-10H2,2-4H3 |
InChIKey | BDDNPHOMXFFAAI-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)OCC#C |