Home
>
Chemical Reagents>Heterocyclic Building Blocks> tert-Butyl 5'-bromo-1',2'-dihydrospiro[azetidine-3,3'-indole]-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-Butyl 5′-bromo-1′,2′-dihydrospiro[azetidine-3,3′-indole]-1-carboxylate(Cat No.:L007805), is a chemical compound with complex structural features. It contains a spiro[indoline-3,3′-azetidine] core, indicating the presence of a bicyclic structure with an indoline and an azetidine ring system. Additionally, it has a tert-butyl group (C4H9) and a bromine atom (Br) attached to different positions of the bicyclic structure. Compounds with spiro structures are known for their unique geometrical arrangements, often leading to interesting chemical and biological properties.
CAS Number | 2059972-24-4 |
Molecular Formula | C15H19BrN2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 5-bromospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxylate |
InChI | InChI=1S/C15H19BrN2O2/c1-14(2,3)20-13(19)18-8-15(9-18)7-17-12-5-4-10(16)6-11(12)15/h4-6,17H,7-9H2,1-3H3 |
InChIKey | CTOCBSZMSKYICA-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CC2(C1)CNC3=C2C=C(C=C3)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |