Home
>
Chemical Reagents>Heterocyclic Building Blocks> tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-1-carboxylate(Cat No.:L007157), is a chemical compound used in organic synthesis and medicinal chemistry research. It contains an indazole ring, a five-membered heterocyclic structure containing nitrogen atoms, with a tert-butyl group at the 6th position and a boron-containing boron ring at the 4th position. This compound is valuable in Suzuki-Miyaura coupling reactions, facilitating the construction of complex organic frameworks. Its unique structure enables diverse chemical transformations, making it crucial for creating specialized organic compounds. Researchers use it as a key intermediate, contributing to advancements in drug discovery and the development of advanced materials.
CAS Number | 890839-29-9 |
Molecular Formula | C18H25BN2O4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole-1-carboxylate |
InChI | InChI=1S/C18H25BN2O4/c1-16(2,3)23-15(22)21-14-10-13(9-8-12(14)11-20-21)19-24-17(4,5)18(6,7)25-19/h8-11H,1-7H3 |
InChIKey | YUDDGOUBTYNGSF-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NN3C(=O)OC(C)(C)C |