For research use only. Not for therapeutic Use.
tert-Butyl Alcohol-d10(Cat No.:R069717)is a fully deuterated compound featuring ten deuterium atoms, essential for advanced pharmaceutical and chemical research. This isotopically labeled version of tert-butyl alcohol is crucial for studying metabolic pathways, reaction mechanisms, and solvent effects. Its stable isotope labeling ensures precise and reliable analytical results, ideal for mass spectrometry and NMR applications. With enhanced stability and consistency, tert-Butyl Alcohol-d10 integrates seamlessly into various experimental setups, providing a robust solution for high-precision scientific investigations. Perfect for organic synthesis and biochemical studies, it supports cutting-edge research in medicinal and environmental chemistry.
CAS Number | 53001-22-2 |
Synonyms | 2-Methyl-2-propanol-d10, tert-Butanol-d10, 1,1-Dimethylethanol-d10 |
Molecular Formula | C4H10O |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1,1,1,3,3,3-hexadeuterio-2-deuteriooxy-2-(trideuteriomethyl)propane |
InChI | InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3/i1D3,2D3,3D3,5D |
InChIKey | DKGAVHZHDRPRBM-SGLLWXCUSA-N |
SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O[2H] |