For research use only. Not for therapeutic Use.
tert-Butyl N-[1-(piperidin-4-yl)ethyl]carbamate(Cat No.:L007293), This substance finds applications in medicinal chemistry, particularly in the development of pharmaceuticals. The piperidine moiety in its structure often contributes to its biological activity, making it a valuable building block for designing molecules with potential therapeutic effects. Researchers utilize this compound to synthesize new drugs and study their interactions with biological systems, aiming to create innovative treatments for various medical conditions. Its versatile nature makes it a valuable tool in drug discovery and development processes.
CAS Number | 863560-23-0 |
Molecular Formula | C12H24N2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-(1-piperidin-4-ylethyl)carbamate |
InChI | InChI=1S/C12H24N2O2/c1-9(10-5-7-13-8-6-10)14-11(15)16-12(2,3)4/h9-10,13H,5-8H2,1-4H3,(H,14,15) |
InChIKey | KREFOLREHRBMLM-UHFFFAOYSA-N |
SMILES | CC(C1CCNCC1)NC(=O)OC(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |