For research use only. Not for therapeutic Use.
tert-Butyl (S)-(1-(3-aminophenyl)ethyl)carbamate (Cat.No:L004070) is a significant compound in pharmaceutical research. Its unique structure, combining a tert-butyl carbamate and an aminophenyl moiety, imparts distinctive pharmacological potential. This compound serves as a valuable scaffold in the development of bioactive molecules, particularly in the field of medicinal chemistry.
CAS Number | 1610767-01-5 |
Molecular Formula | C13H20N2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-[(1S)-1-(3-aminophenyl)ethyl]carbamate |
InChI | InChI=1S/C13H20N2O2/c1-9(10-6-5-7-11(14)8-10)15-12(16)17-13(2,3)4/h5-9H,14H2,1-4H3,(H,15,16)/t9-/m0/s1 |
InChIKey | QZEKBDHFLADZKW-VIFPVBQESA-N |
SMILES | C[C@@H](C1=CC(=CC=C1)N)NC(=O)OC(C)(C)C |