For research use only. Not for therapeutic Use.
Terutroban（Cat No.:I002164）is a selective thromboxane A2 receptor antagonist with antiplatelet and vasodilatory properties. It works by inhibiting the effects of thromboxane, a compound involved in platelet aggregation and vasoconstriction, thus reducing the risk of blood clot formation. Terutroban has been investigated for its potential in treating cardiovascular conditions such as atherosclerosis, stroke prevention, and peripheral artery disease. By blocking thromboxane receptors, it helps prevent arterial thrombosis while improving blood flow, making it a promising agent in managing cardiovascular diseases linked to clotting and vascular dysfunction.
| Catalog Number | I002164 |
| CAS Number | 165538-40-9 |
| Synonyms | (6R)-6-[[(4-chlorophenyl)sulfonyl]amino]-5,6,7,8-tetrahydro-2-methyl-1-naphthalenepropanoic |
| Molecular Formula | C20H22ClNO4S |
| Purity | ≥95% |
| Target | Prostanoid Receptors |
| Solubility | DMSO: ≥ 30 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 3-[(6R)-6-[(4-chlorophenyl)sulfonylamino]-2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl]propanoic acid |
| InChI | InChI=1S/C20H22ClNO4S/c1-13-2-3-14-12-16(6-9-19(14)18(13)10-11-20(23)24)22-27(25,26)17-7-4-15(21)5-8-17/h2-5,7-8,16,22H,6,9-12H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | HWEOXFSBSQIWSY-MRXNPFEDSA-N |
| SMILES | CC1=C(C2=C(C[C@@H](CC2)NS(=O)(=O)C3=CC=C(C=C3)Cl)C=C1)CCC(=O)O |
| Reference | <p style=/line-height:25px/> |
