For research use only. Not for therapeutic Use.
TES sodium (Cat No.:I043110) is a salt derived from triethanolamine (TEA), a common organic compound used as a buffering agent in various chemical formulations. It is widely used in biochemistry and pharmaceutical applications to maintain a stable pH in solutions, ensuring optimal conditions for enzymatic reactions or other biochemical processes. TES sodium is also utilized in cosmetics and personal care products as a pH stabilizer and emulsifier. Its ability to form stable buffers in both aqueous and organic systems makes it valuable in research, drug formulation, and manufacturing processes.
| CAS Number | 70331-82-7 |
| Synonyms | sodium;2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonate |
| Molecular Formula | C6H14NNaO6S |
| Purity | ≥95% |
| IUPAC Name | sodium;2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]ethanesulfonate |
| InChI | InChI=1S/C6H15NO6S.Na/c8-3-6(4-9,5-10)7-1-2-14(11,12)13;/h7-10H,1-5H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | GUXMFAHOYNRHBI-UHFFFAOYSA-M |
| SMILES | C(CS(=O)(=O)[O-])NC(CO)(CO)CO.[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
