For research use only. Not for therapeutic Use.
Tetrabenzylthiuram disulfide (Cat.No:M052460) is a chemical compound often employed as an accelerator in the vulcanization of rubber, particularly for the production of tires and industrial rubber products. It plays a crucial role in cross-linking rubber polymers, enhancing their strength, elasticity, and resistance to wear and tear.
CAS Number | 10591-85-2 |
Molecular Formula | C30H28N2S4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dibenzylcarbamothioylsulfanyl N,N-dibenzylcarbamodithioate |
InChI | InChI=1S/C30H28N2S4/c33-29(31(21-25-13-5-1-6-14-25)22-26-15-7-2-8-16-26)35-36-30(34)32(23-27-17-9-3-10-18-27)24-28-19-11-4-12-20-28/h1-20H,21-24H2 |
InChIKey | WITDFSFZHZYQHB-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=S)SSC(=S)N(CC3=CC=CC=C3)CC4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |