For research use only. Not for therapeutic Use.
Tetrabutylammonium tetraphenylborate(Cat No.:M076645) is a quaternary ammonium salt composed of a tetrabutylammonium cation and a tetraphenylborate anion. This compound is commonly used as a phase-transfer catalyst in organic synthesis reactions. It facilitates the transfer of ions or reactants between immiscible phases, typically between an aqueous phase and an organic phase. Tetrabutylammonium tetraphenylborate enables the synthesis of various organic compounds by promoting reactions that would otherwise be hindered by poor solubility or compatibility between reactants. Its effectiveness as a phase-transfer catalyst makes it valuable in the production of pharmaceuticals, agrochemicals, and specialty chemicals.
CAS Number | 15522-59-5 |
Synonyms | TETRA-N-BUTYLAMMONIUM TETRAPHENYLBORATE; |
Molecular Formula | C40H56BN |
Purity | 97% |
Storage | -20°C |
Analysis method | HPLC |
IUPAC Name | tetrabutylazanium;tetraphenylboranuide |
InChI | InChI=1S/C24H20B.C16H36N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h1-20H;5-16H2,1-4H3/q-1;+1 |
InChIKey | ZHCCBGAUZWZGQV-UHFFFAOYSA-N |
SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.CCCC[N+](CCCC)(CCCC)CCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |