For research use only. Not for therapeutic Use.
Tetrachloroethylene, also known as perchloroethylene or PCE, is a colorless liquid widely used in dry cleaning and metal degreasing processes. Despite its effectiveness in removing stains and grease, it poses health risks due to its toxic nature and potential to contaminate groundwater. Prolonged exposure to tetrachloroethylene can cause respiratory issues, neurological problems, and even cancer. Thus, stringent safety measures are necessary when handling or using this chemical.
| Catalog Number | R044532 |
| CAS Number | 127-18-4 |
| Synonyms | 1,1,2,2-Tetrachloroethene; ?Tetrachloroethene; 1,1,2,2-Tetrachloroethylene; Ankilostin; Antisal 1; Asahi Perchlor; Didakene; Dilatin PT; Ethylene tetrachloride; F 1110; F 1110 (Halocarbon); Fedal-Un; Freon 1110; LXGL 15; NSC 9777; Nema; PCE; |
| Molecular Formula | C2Cl4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,1,2,2-tetrachloroethene |
| InChI | InChI=1S/C2Cl4/c3-1(4)2(5)6 |
| InChIKey | CYTYCFOTNPOANT-UHFFFAOYSA-N |
| SMILES | C(=C(Cl)Cl)(Cl)Cl |
