For research use only. Not for therapeutic Use.
Tetracosamethylcyclododecasiloxane（Cat No.:M081344）, commonly abbreviated as D12, is a synthetic organosilicon compound known for its complex cyclic structure containing twelve silicon atoms linked by oxygen atoms, with each silicon atom having two methyl groups attached. This molecular architecture makes D12 a larger and more stable member of the cyclomethylsiloxane family. It is primarily used in the production of silicone polymers and elastomers, where it contributes to the materials’ heat stability and chemical resistance. The compound is valuable in industries requiring durable, flexible, and weather-resistant materials, such as automotive, aerospace, and electronics.
| Catalog Number | M081344 |
| CAS Number | 18919-94-3 |
| Molecular Formula | C24H72O12Si12 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16,18,18,20,20,22,22,24,24-tetracosamethyl-1,3,5,7,9,11,13,15,17,19,21,23-dodecaoxa-2,4,6,8,10,12,14,16,18,20,22,24-dodecasilacyclotetracosane |
| InChI | InChI=1S/C24H72O12Si12/c1-37(2)25-38(3,4)27-40(7,8)29-42(11,12)31-44(15,16)33-46(19,20)35-48(23,24)36-47(21,22)34-45(17,18)32-43(13,14)30-41(9,10)28-39(5,6)26-37/h1-24H3 |
| InChIKey | SOGKSNZFDBFKCV-UHFFFAOYSA-N |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)C |
