For research use only. Not for therapeutic Use.
TETRADECAMETHYLHEXASILOXANE (CAS 107-52-8) is a colorless to almost colorless clear liquid, can be used as antifoaming agent.
| Catalog Number | M068006 |
| CAS Number | 107-52-8 |
| Synonyms | Hexasiloxane, tetradecamethyl- |
| Molecular Formula | C14H42O5Si6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| InChI | InChI=1S/C14H42O5Si6/c1-20(2,3)15-22(7,8)17-24(11,12)19-25(13,14)18-23(9,10)16-21(4,5)6/h1-14H3 |
| InChIKey | ADANNTOYRVPQLJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| Reference | 1. <span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Son, Min-Hui, et al. "Identification of polydimethylsiloxane (PDMS) in antifoaming agent using headspace-SPME-GC/MS and its effects to power plant thermal effluent." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">한국분석과학회 학술대회</i><span style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;"> (2016): 275-275.</span> |
