For research use only. Not for therapeutic Use.
Tetradecyl benzoate (Cat.No:L004206) is a notable chemical compound widely utilized in the formulation of personal care and cosmetic products. Its distinctive structure, combining a tetradecyl group and benzoate ester, imparts specific emollient and conditioning properties. This compound serves as a crucial ingredient in skincare and haircare formulations, contributing to their texture and feel.
CAS Number | 70682-72-3 |
Molecular Formula | C21H34O2 |
Purity | ≥95% |
IUPAC Name | tetradecyl benzoate |
InChI | InChI=1S/C21H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-19-23-21(22)20-17-14-13-15-18-20/h13-15,17-18H,2-12,16,19H2,1H3 |
InChIKey | YQOBYINWABKLFC-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCOC(=O)C1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |