For research use only. Not for therapeutic Use.
Tetradehydropodophyllotoxin(Cat No.:R042078)is a synthetic compound derived from podophyllotoxin, known for its potent antitumor activity. This molecule inhibits the enzyme topoisomerase II, essential for DNA replication and transcription, leading to DNA damage and cell death in rapidly dividing cancer cells. Tetradehydropodophyllotoxin has been explored for its potential in cancer therapy, particularly in treating tumors resistant to conventional chemotherapy. Its mechanism of action and pharmacological properties make it a promising candidate for further development in oncology. Researchers are investigating its efficacy and safety in clinical trials for targeted cancer therapies.
CAS Number | 42123-27-3 |
Synonyms | 9-Hydroxy-5-(3,4,5-trimethoxyphenyl)-furo[3’,4’:6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one; Dehydropodophyllotoxin |
Molecular Formula | C22H18O8 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | 5-hydroxy-9-(3,4,5-trimethoxyphenyl)-6H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
InChI | InChI=1S/C22H18O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,23H,8-9H2,1-3H3 |
InChIKey | HSSDVCMYTACNSM-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1OC)OC)C2=C3C(=C(C4=CC5=C(C=C42)OCO5)O)COC3=O |