For research use only. Not for therapeutic Use.
Tetradifon（Cat No.:M068386）is a selective organochlorine acaricide widely used to control mite infestations on crops such as fruits, vegetables, and ornamentals. It acts by disrupting the energy metabolism of mites, targeting both larval and adult stages, while being relatively safe for beneficial insects. Tetradifon is valued for its long residual activity and effectiveness against resistant mite populations. Its specific action and low toxicity to non-target organisms make it a useful tool in integrated pest management strategies, contributing to sustainable agricultural practices and improved crop protection.
| Catalog Number | M068386 |
| CAS Number | 116-29-0 |
| Molecular Formula | C12H6Cl4O2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,2,4-trichloro-5-(4-chlorophenyl)sulfonylbenzene |
| InChI | InChI=1S/C12H6Cl4O2S/c13-7-1-3-8(4-2-7)19(17,18)12-6-10(15)9(14)5-11(12)16/h1-6H |
| InChIKey | MLGCXEBRWGEOQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)C2=CC(=C(C=C2Cl)Cl)Cl)Cl |
