For research use only. Not for therapeutic Use.
Tetrafluoro-1,4-benzoquinone(Cat No.:L006928), is a chemical compound with the molecular formula C6F4O2. It is a derivative of benzoquinone where all four hydrogen atoms are replaced by fluorine atoms. This white solid is a powerful oxidizing agent used in various chemical reactions, including polymerizations and as a bleach activator in laundry detergents. It also finds applications in the synthesis of specialty chemicals and pharmaceuticals. Tetrafluoro-1,4-benzoquinone’s strong oxidative properties are harnessed in diverse industrial processes, making it a valuable compound in fields such as organic chemistry, materials science, and chemical manufacturing.
CAS Number | 527-21-9 |
Molecular Formula | C6F4O2 |
Purity | ≥95% |
IUPAC Name | 2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C6F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
InChIKey | JKLYZOGJWVAIQS-UHFFFAOYSA-N |
SMILES | C1(=C(C(=O)C(=C(C1=O)F)F)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |