Tetrafluorohydroquinone（Cat No.:L006927）, is an organic compound. It is a derivative of hydroquinone, where all four hydrogen atoms are replaced by fluorine atoms. This white crystalline solid is primarily used as a photographic developer and as a chemical intermediate in the synthesis of dyes and pharmaceuticals. Its ability to form stable complexes with metals and its electron-donating properties make it valuable in various organic reactions. Tetrafluorohydroquinone’s unique chemical properties are harnessed in specialized applications, contributing to advancements in fields like photography, organic synthesis, and material science.
| Catalog Number | L006927 |
| CAS Number | 771-63-1 |
| Molecular Formula | C6H2F4O2 |
| Purity | ≥95% |
| IUPAC Name | 2,3,5,6-tetrafluorobenzene-1,4-diol |
| InChI | InChI=1S/C6H2F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11/h11-12H |
| InChIKey | ZSDAMBJDFDRLSS-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)O)F)F)O |
