Tetrafluorohydroquinone(Cat No.:L006927), is an organic compound. It is a derivative of hydroquinone, where all four hydrogen atoms are replaced by fluorine atoms. This white crystalline solid is primarily used as a photographic developer and as a chemical intermediate in the synthesis of dyes and pharmaceuticals. Its ability to form stable complexes with metals and its electron-donating properties make it valuable in various organic reactions. Tetrafluorohydroquinone’s unique chemical properties are harnessed in specialized applications, contributing to advancements in fields like photography, organic synthesis, and material science.
Catalog Number | L006927 |
CAS Number | 771-63-1 |
Molecular Formula | C6H2F4O2 |
Purity | ≥95% |
IUPAC Name | 2,3,5,6-tetrafluorobenzene-1,4-diol |
InChI | InChI=1S/C6H2F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11/h11-12H |
InChIKey | ZSDAMBJDFDRLSS-UHFFFAOYSA-N |
SMILES | C1(=C(C(=C(C(=C1F)F)O)F)F)O |