For research use only. Not for therapeutic Use.
Tetraglycine（Cat No.:I042717）is a peptide composed of four glycine amino acids linked together in a linear chain. As a simple oligopeptide, it is often used in biochemical research to study protein structure, interactions, and enzyme activity. Tetraglycine’s small size and flexibility make it a useful model for understanding peptide bond formation and stability. It also has applications in drug development, particularly in the synthesis of larger peptide-based molecules. Additionally, tetraglycine may be studied for its potential roles in metabolic processes and as a precursor for more complex peptide sequences in biological research.
| CAS Number | 637-84-3 |
| Synonyms | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| Molecular Formula | C8H14N4O5 |
| Purity | ≥95% |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]acetic acid |
| InChI | InChI=1S/C8H14N4O5/c9-1-5(13)10-2-6(14)11-3-7(15)12-4-8(16)17/h1-4,9H2,(H,10,13)(H,11,14)(H,12,15)(H,16,17) |
| InChIKey | QMOQBVOBWVNSNO-UHFFFAOYSA-N |
| SMILES | C(C(=O)NCC(=O)NCC(=O)NCC(=O)O)N |
