For research use only. Not for therapeutic Use.
Tetrahydrofurfuryl propionate (CAT: I014735) is a chemical compound that belongs to the class of furan derivatives. It is commonly used as a flavor and fragrance ingredient due to its pleasant fruity and floral aroma. This compound is often utilized in the formulation of perfumes, cosmetics, and various consumer products. Its unique odor profile makes it suitable for enhancing the sensory experience of a wide range of products. Additionally, tetrahydrofurfuryl propionate can also be employed as a solvent or additive in industrial applications, demonstrating its versatility across different fields.
| Catalog Number | I014735 |
| CAS Number | 637-65-0 |
| Synonyms | Tetrahydrofurfuryl propionate; AI3-15415; AI3 15415; AI315415;2-Furanmethanol, tetrahydro-, 2-propanoate |
| Molecular Formula | C8H13O4- |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C8H14O4/c9-6-8(3-1-5-12-8)4-2-7(10)11/h9H,1-6H2,(H,10,11)/p-1 |
| InChIKey | STDNIHBPMIGZNU-UHFFFAOYSA-M |
| SMILES | OCC1(CCC([O-])=O)OCCC1 |
