For research use only. Not for therapeutic Use.
(TETRAHYDROFURFURYLOXYPROPYL)METHYLSILOXANE, 5cSt (Cat. No: M142096) can be used as pharmaceutical synthesis intermediates and organic synthesis intermediates, mainly used in laboratory research and chemical pharmaceutical synthesis processes.
| Catalog Number | M142096 |
| CAS Number | 1361237-41-3 |
| Molecular Formula | C15H36O4Si3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | trimethyl-[methyl-[3-(oxolan-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilane |
| InChI | InChI=1S/C15H36O4Si3/c1-20(2,3)18-22(7,19-21(4,5)6)13-9-11-16-14-15-10-8-12-17-15/h15H,8-14H2,1-7H3 |
| InChIKey | VQPDTOYEOLMPCD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOCC1CCCO1)O[Si](C)(C)C |
