For research use only. Not for therapeutic Use.
Tetrahydroxymethoxychalcone（Cat No.:I044799）is a polyphenolic compound belonging to the chalcone family, characterized by a flavonoid backbone with four hydroxyl groups and one methoxy group. Found in various plants, particularly in licorice (Glycyrrhiza species), it exhibits a range of biological activities, including antioxidant, anti-inflammatory, and anticancer effects. Its structure allows for effective free radical scavenging and modulation of cellular signaling pathways. Tetrahydroxymethoxychalcone has been studied for its potential in treating metabolic disorders, supporting liver health, and inhibiting tumor growth, making it a valuable candidate in natural product research and therapeutic development.
| CAS Number | 197227-39-7 |
| Synonyms | (E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-(3,4-dihydroxyphenyl)prop-2-en-1-one |
| Molecular Formula | C16H14O6 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-(3,4-dihydroxyphenyl)prop-2-en-1-one |
| InChI | InChI=1S/C16H14O6/c1-22-16-9(3-7-13(19)15(16)21)2-5-11(17)10-4-6-12(18)14(20)8-10/h2-8,18-21H,1H3/b5-2+ |
| InChIKey | BICPGUILWBQAEY-GORDUTHDSA-N |
| SMILES | COC1=C(C=CC(=C1O)O)/C=C/C(=O)C2=CC(=C(C=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
