For research use only. Not for therapeutic Use.
Tetrahydroxyquinone(Cat No.:I003140)is a chemical compound that belongs to the quinone family, characterized by a benzene ring with multiple hydroxyl (-OH) groups. It has four hydroxyl groups attached to the quinone structure, giving it potential for various chemical and biological applications. This compound has been studied for its antioxidant properties, which may offer protective effects against oxidative stress in cells. Additionally, tetrahydroxyquinone may have antimicrobial, anticancer, or anti-inflammatory activities, making it a subject of interest in pharmaceutical and biomedical research. Its stability and interactions with other molecules are areas of ongoing study.
CAS Number | 319-89-1 |
Molecular Formula | C6H4O6 |
Purity | ≥95% |
Target | NF-κB |
Solubility | DMSO: ≥ 1.6 mg/mL |
Storage | -20 ℃ |
IUPAC Name | 2,3,5,6-tetrahydroxycyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C6H4O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h7-8,11-12H |
InChIKey | DGQOCLATAPFASR-UHFFFAOYSA-N |
SMILES | C1(=C(C(=O)C(=C(C1=O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |