For research use only. Not for therapeutic Use.
Tetraisopropyl orthosilicate (Cat No.:M121854) is a colorless liquid used primarily as a precursor in the synthesis of silica and silicon-based materials. It is composed of four isopropyl groups attached to a central silicon atom, and it readily reacts with water to form silica particles. TIOS is commonly employed in the production of silicone resins, sealants, and coatings, where it serves as a crosslinking agent to enhance material properties such as hardness, adhesion, and thermal stability. Additionally, TIOS is used in the manufacture of specialty glasses, and ceramics, and as a catalyst in organic synthesis.
Catalog Number | M121854 |
CAS Number | 1992-48-9 |
Molecular Formula | C12H28O4Si |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tetrapropan-2-yl silicate |
InChI | InChI=1S/C12H28O4Si/c1-9(2)13-17(14-10(3)4,15-11(5)6)16-12(7)8/h9-12H,1-8H3 |
InChIKey | ZUEKXCXHTXJYAR-UHFFFAOYSA-N |
SMILES | CC(C)O[Si](OC(C)C)(OC(C)C)OC(C)C |