For research use only. Not for therapeutic Use.
Tetrakis(4-vinylphenyl)methane (Cat.No:L003760) is a crucial compound in materials science. Its unique molecular structure, with four vinylphenyl groups attached to a central carbon, imparts significant reactivity. This compound serves as a valuable precursor for the synthesis of specialized polymers and materials used in a range of applications, including electronics and coatings. Its versatile nature and role in creating tailored materials underscore its importance in the field of advanced materials and industrial chemistry.
CAS Number | 188647-25-8 |
Molecular Formula | C33H28 |
Purity | ≥95% |
IUPAC Name | 1-ethenyl-4-[tris(4-ethenylphenyl)methyl]benzene |
InChI | InChI=1S/C33H28/c1-5-25-9-17-29(18-10-25)33(30-19-11-26(6-2)12-20-30,31-21-13-27(7-3)14-22-31)32-23-15-28(8-4)16-24-32/h5-24H,1-4H2 |
InChIKey | PSGMDUASGFGGHR-UHFFFAOYSA-N |
SMILES | C=CC1=CC=C(C=C1)C(C2=CC=C(C=C2)C=C)(C3=CC=C(C=C3)C=C)C4=CC=C(C=C4)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |