For research use only. Not for therapeutic Use.
Tetramethylammonium p-toluenesulfonate(Cat No.:L006925), is a quaternary ammonium salt with the chemical formula C9H14NO3S. It consists of a tetramethylammonium cation (N(CH3)4⁺) and a p-toluenesulfonate anion (C7H7SO3⁻). This compound is widely used in organic chemistry as a phase-transfer catalyst, aiding the transfer of reactants between immiscible phases. It enhances the efficiency of various chemical reactions, especially those involving anionic species. Tetramethylammonium p-toluenesulfonate is essential in synthesis protocols, including nucleophilic substitutions and alkylations. Its application simplifies reaction conditions, leading to improved yields and selectivity, making it valuable in both academic research and industrial production processes.
CAS Number | 3983-91-3 |
Molecular Formula | C11H19NO3S |
Purity | ≥95% |
IUPAC Name | 4-methylbenzenesulfonate;tetramethylazanium |
InChI | InChI=1S/C7H8O3S.C4H12N/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(2,3)4/h2-5H,1H3,(H,8,9,10);1-4H3/q;+1/p-1 |
InChIKey | FHVCZJGBXWNGIZ-UHFFFAOYSA-M |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+](C)(C)C |