For research use only. Not for therapeutic Use.
Tetramethylkaempferol（Cat No.:M083407）is a flavonoid compound derived from kaempferol, a naturally occurring plant polyphenol. It is characterized by the presence of four methyl groups attached to the kaempferol structure. Tetramethylkaempferol exhibits antioxidant, anti-inflammatory, and anticancer properties. It has been shown to modulate various signaling pathways, including those involved in cell proliferation, apoptosis, and oxidative stress, making it a potential candidate for therapeutic applications in cancer and chronic inflammatory diseases. Its bioactive properties contribute to its potential use in natural medicine and as a dietary supplement for health promotion.
| CAS Number | 16692-52-7 |
| Synonyms | 3,5,7-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| Molecular Formula | C19H18O6 |
| Purity | ≥95% |
| IUPAC Name | 3,5,7-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChI | InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)18-19(24-4)17(20)16-14(23-3)9-13(22-2)10-15(16)25-18/h5-10H,1-4H3 |
| InChIKey | YZWIIEJLESXODL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)OC)OC |
