For research use only. Not for therapeutic Use.
Tetramethylpyrazine（Cat No.:R043597）, is a chemical compound also known as ligustrazine. It is a natural product isolated from the rhizome of the Chinese medicinal herb Ligusticum chuanxiong. Tetramethylpyrazine is widely used in traditional Chinese medicine and has been studied for its various pharmacological properties. It exhibits neuroprotective, cardiovascular protective, anti-inflammatory, and antioxidant effects. Due to its diverse therapeutic potential, Tetramethylpyrazine is of interest in pharmaceutical and medical research for the treatment of various conditions, including cardiovascular and neurological disorders.
| Catalog Number | R043597 |
| CAS Number | 1124-11-4 |
| Synonyms | 2,3,5,6-Tetramethyl-pyrazine; Tetramethyl-pyrazine; BS factor; Chuanxingzine; Ligustrazin; Ligustrazine; NSC 36080; NSC 46451; Tetrapyrazine |
| Molecular Formula | C8H12N2 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | RT |
| IUPAC Name | 2,3,5,6-tetramethylpyrazine |
| InChI | InChI=1S/C8H12N2/c1-5-6(2)10-8(4)7(3)9-5/h1-4H3 |
| InChIKey | FINHMKGKINIASC-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C)C)C |
