For research use only. Not for therapeutic Use.
Tetramethylrhodamine-5-iodoacetamide dihydroiodide (Cat.No:M017813) is a fluorescent dye used in biochemical and molecular biology research. It is often employed to label and detect proteins and other biomolecules through fluorescence microscopy and other analytical techniques. Its high sensitivity and stability make it valuable in a wide range of biological applications.
| Catalog Number | M017813 |
| CAS Number | 114458-99-0 |
| Molecular Formula | C26H24IN3O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-[3,6-bis(dimethylamino)xanthen-9-ylidene]-3-(2-iodoacetyl)iminocyclohexa-1,4-diene-1-carboxylic acid |
| InChI | InChI=1S/C26H24IN3O4/c1-29(2)16-6-9-19-22(12-16)34-23-13-17(30(3)4)7-10-20(23)25(19)18-8-5-15(28-24(31)14-27)11-21(18)26(32)33/h5-13H,14H2,1-4H3,(H,32,33) |
| InChIKey | UONQCTUIVAFVBI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=NC(=O)CI)C=C3C(=O)O)C4=C(O2)C=C(C=C4)N(C)C |
