For research use only. Not for therapeutic Use.
Tetrandrine is a bisbenzylisoquinoline alkaloid derived from the plant Stephania tetrandra. It has been studied for its antihypertensive, anti-inflammatory, and antifibrotic properties. Tetrandrine is thought to work by blocking calcium channels, which helps relax blood vessels and reduce blood pressure. It has also shown potential in treating conditions like arrhythmias, chronic obstructive pulmonary disease (COPD), and cancer. Additionally, tetrandrine is being explored for its ability to modulate immune responses and inhibit fibrosis in various organs.
| Catalog Number | R014980 |
| CAS Number | 518-34-3 |
| Synonyms | (4aS,16aS)-3,4,4a,5,16a,17,18,19-octahydro-12,21,22,26-tetramethoxy-4,17-dimethyl-16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2’,3’:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinoline; |
| Molecular Formula | C38H42N2O6 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | store at -20℃ |
| IUPAC Name | (1S,14S)-9,20,21,25-tetramethoxy-15,30-dimethyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18,20,22(33),24,26,31-dodecaene |
| InChI | InChI=1S/C38H42N2O6/c1-39-15-13-25-20-32(42-4)34-22-28(25)29(39)17-23-7-10-27(11-8-23)45-33-19-24(9-12-31(33)41-3)18-30-36-26(14-16-40(30)2)21-35(43-5)37(44-6)38(36)46-34/h7-12,19-22,29-30H,13-18H2,1-6H3/t29-,30-/m0/s1 |
| InChIKey | WVTKBKWTSCPRNU-KYJUHHDHSA-N |
| SMILES | CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
