For research use only. Not for therapeutic Use.
Tetrapentylammonium bromide（Cat No.:I041507）is a quaternary ammonium salt composed of a pentyl group (C5H11) attached to a nitrogen atom, with bromide (Br) as the counter ion. It is commonly used in organic synthesis, as a phase transfer catalyst, or as an electrolyte in electrochemical applications. The long alkyl chains in the molecule enhance its solubility in nonpolar solvents, making it useful in various chemical processes. Tetrapentylammonium bromide can facilitate reactions that involve ionic species, by aiding the transfer of ions between different phases, such as aqueous and organic solvents.
| CAS Number | 866-97-7 |
| Synonyms | tetrapentylazanium;bromide |
| Molecular Formula | C20H44BrN |
| Purity | ≥95% |
| IUPAC Name | tetrapentylazanium;bromide |
| InChI | InChI=1S/C20H44N.BrH/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SPALIFXDWQTXKS-UHFFFAOYSA-M |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.[Br-] |
