For research use only. Not for therapeutic Use.
Tetraphyllicine(Cat No.:I037152)is a chemical compound studied for its potential pharmacological properties, particularly in the field of cancer research. It is a derivative of the natural product phyllanthin, a lignan found in certain plants like Phyllanthus species. Tetraphyllicine has shown promise as an inhibitor of cell proliferation and has demonstrated cytotoxic effects against various cancer cell lines. Its mechanism of action is believed to involve the disruption of key cellular processes such as apoptosis and cell cycle regulation. However, further studies are necessary to better understand its efficacy, safety, and potential therapeutic applications.
CAS Number | 509-38-6 |
Synonyms | Tetraphyllicine |
Molecular Formula | C20H24N2O |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | (1R,9R,10S,12R,13E,16S,17S,18R)-13-ethylidene-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-ol |
InChI | InChI=1S/C20H24N2O/c1-3-11-10-22-15-8-12(11)17-16(22)9-20(19(17)23)13-6-4-5-7-14(13)21(2)18(15)20/h3-7,12,15-19,23H,8-10H2,1-2H3/b11-3-/t12-,15-,16-,17-,18-,19+,20+/m0/s1 |
InChIKey | VBEQZFNVRMPLSM-MVVFEDHTSA-N |
SMILES | C/C=C\1/CN2[C@H]3C[C@@H]1[C@H]4[C@@H]2C[C@@]5([C@H]3N(C6=CC=CC=C65)C)[C@@H]4O |
Reference | 1: Duncan RJ, Nash CB. Electropharmacology of the rauwolfia alkaloids, ajmaline tetraphyllicine, and serpentine on the canine heart. Arch Int Pharmacodyn Ther. 1973 Nov;206(1):181-90. PubMed PMID: 4775934. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |