Tetrasodium glutamate diacetate（Cat No.:I014737） is a versatile, clear, liquid chelating agent and preservative booster. Derived from plant material, it is readily biodegradable and highly soluble across a broad pH range. This compound effectively fulfills the same purpose in formulations as EDTA but without the associated health and environmental concerns. It acts as a safe alternative, offering effective chelation and preservation properties without compromising on performance.
| Catalog Number | I014737 |
| CAS Number | 51981-21-6 |
| Synonyms | Tetrasodium glutamate diacetate;;tetrasodium mono((S)-2-(bis(carboxymethyl)amino)-4-carboxybutanoate) |
| Molecular Formula | C9H12NNa4O83 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| IUPAC Name | tetrasodium;(2S)-2-[bis(carboxylatomethyl)amino]pentanedioate |
| InChI | InChI=1S/C9H13NO8.4Na/c11-6(12)2-1-5(9(17)18)10(3-7(13)14)4-8(15)16;;;;/h5H,1-4H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18);;;;/q;4*+1/p-4/t5-;;;;/m0..../s1 |
| InChIKey | UZVUJVFQFNHRSY-OUTKXMMCSA-J |
| SMILES | C(CC(=O)[O-])C(C(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
