For research use only. Not for therapeutic Use.
Tetrasodium iminodisuccinate（Cat No.:M101576）is a chelating agent commonly used in various industrial and household products. Structurally, it is derived from iminodisuccinic acid, with four sodium ions replacing the hydrogen atoms to increase solubility and enhance performance. This compound excels in binding metal ions, which helps prevent metal-induced degradation and improves the efficiency of detergents and cleaners. It is biodegradable and considered environmentally friendly compared to traditional phosphates and other less biodegradable chelators. Tetrasodium iminodisuccinate is utilized in applications ranging from water treatment to personal care products.
| Catalog Number | M101576 |
| CAS Number | 144538-83-0 |
| Molecular Formula | C8H7NNa4O8 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | tetrasodium;2-(1,2-dicarboxylatoethylamino)butanedioate |
| InChI | InChI=1S/C8H11NO8.4Na/c10-5(11)1-3(7(14)15)9-4(8(16)17)2-6(12)13;;;;/h3-4,9H,1-2H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17);;;;/q;4*+1/p-4 |
| InChIKey | GYBINGQBXROMRS-UHFFFAOYSA-J |
| SMILES | C(C(C(=O)[O-])NC(CC(=O)[O-])C(=O)[O-])C(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
