For research use only. Not for therapeutic Use.
Tetrazine-Biotin(CAT: I015262) is a versatile, high-purity bioconjugation reagent designed for advanced research in chemical biology and molecular imaging. Combining the reactivity of tetrazine with the affinity of biotin for streptavidin, it enables efficient and selective labeling of biomolecules through bioorthogonal reactions such as inverse-electron-demand Diels-Alder (IEDDA) cycloaddition. Tetrazine-Biotin is widely used in applications such as protein labeling, cell imaging, and proximity-based assays. Its stability and precise performance make it a reliable tool for studying molecular interactions and optimizing detection systems in complex biological environments. Ideal for in vitro and in vivo research, it enhances experimental versatility and precision.
| Catalog Number | I015262 |
| CAS Number | 1714123-51-9 |
| Molecular Formula | C₁₉H₂₃N₇O₂S |
| Purity | ≥95% |
| Target | ADC Linker |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]pentanamide |
| InChI | InChI=1S/C19H23N7O2S/c27-16(4-2-1-3-15-17-14(10-29-15)23-19(28)24-17)20-9-12-5-7-13(8-6-12)18-25-21-11-22-26-18/h5-8,11,14-15,17H,1-4,9-10H2,(H,20,27)(H2,23,24,28)/t14-,15-,17-/m0/s1 |
| InChIKey | GBJXXSUDJUYIIH-ZOBUZTSGSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCC3=CC=C(C=C3)C4=NN=CN=N4)NC(=O)N2 |
