For research use only. Not for therapeutic Use.
Tetrazine-PEG4-amine (hydrochloride) is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Tetrazine-PEG4-amine (hydrochloride) is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups.
ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1].
| Catalog Number | I045861 |
| CAS Number | 2752945-36-9 |
| Synonyms | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]propanamide;hydrochloride |
| Molecular Formula | C20H31ClN6O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H30N6O5.ClH/c21-6-8-29-10-12-31-14-13-30-11-9-28-7-5-19(27)22-15-17-1-3-18(4-2-17)20-25-23-16-24-26-20;/h1-4,16H,5-15,21H2,(H,22,27);1H |
| InChIKey | MZMSXPAYFMWVQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)CCOCCOCCOCCOCCN)C2=NN=CN=N2.Cl |
| Reference | [1]. Beck A, et al. Strategies and challenges for the next generation of antibody-drug conjugates. Nat Rev Drug Discov. 2017 May;16(5):315-337. |
