For research use only. Not for therapeutic Use.
Tetrazine-Ph-acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Tetrazine-Ph-acid is a click chemistry reagent, it contains a Tetrazine group that can undergo an inverse electron demand Diels-Alder reaction (iEDDA) with molecules containing TCO groups.
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Catalog Number | I016411 |
| CAS Number | 1380500-92-4 |
| Synonyms | 2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetic acid |
| Molecular Formula | C10H8N4O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C10H8N4O2/c15-9(16)5-7-1-3-8(4-2-7)10-13-11-6-12-14-10/h1-4,6H,5H2,(H,15,16) |
| InChIKey | SLJKKTFIAUAYGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C2=NN=CN=N2 |
| Reference | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
