For research use only. Not for therapeutic Use.
Tetrodotoxin citrate (Cat.No:I002408) is a neurotoxin derived from certain marine organisms, such as pufferfish and some invertebrates. It blocks voltage-gated sodium channels, leading to nerve conduction inhibition and muscle paralysis. While highly toxic, tetrodotoxin citrate is also used in research to study nerve function and pain modulation mechanisms.
CAS Number | 18660-81-6 |
Synonyms | TTX citrate |
Molecular Formula | C17H25N3O15 |
Purity | ≥95% |
Solubility | 100 mM in water |
Storage | -20°C |
IUPAC Name | (1S,5R,6R,7S,9S,11R,12S,13S,14S)-3-amino-14-(hydroxymethyl)-8,10-dioxa-2,4-diazatetracyclo[7.3.1.17,11.01,6]tetradec-3-ene-5,9,12,13,14-pentol;2-hydroxypropane-1,2,3-tricarboxylic acid |
InChI | InChI=1S/C11H17N3O8.C6H8O7/c12-8-13-6(17)2-4-9(19,1-15)5-3(16)10(2,14-8)7(18)11(20,21-4)22-5;7-3(8)1-6(13,5(11)12)2-4(9)10/h2-7,15-20H,1H2,(H3,12,13,14);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t2-,3-,4+,5-,6-,7+,9+,10+,11+;/m1./s1 |
InChIKey | YUJWMDOXROTQCW-WNGAXIQVSA-N |
SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O.C(C1(C2C3C(N=C(NC34C(C1OC(C4O)(O2)O)O)N)O)O)O |
Reference | <p style=/line-height:25px/> </p> |