For research use only. Not for therapeutic Use.
TFAP (CAT: I019813) is a selective inhibitor of cyclooxygenase-1 (COX-1). COX-1 is an enzyme involved in the production of prostaglandins, which play important roles in inflammation, pain, and other physiological processes. By selectively inhibiting COX-1, TFAP interferes with the synthesis of prostaglandins derived from arachidonic acid, leading to reduced inflammation and pain. This selective inhibition of COX-1 distinguishes TFAP from non-selective COX inhibitors, potentially minimizing unwanted side effects associated with COX-2 inhibition. TFAP’s selective COX-1 inhibitory activity may have therapeutic applications in conditions such as arthritis, cardiovascular diseases, and other inflammatory disorders.
| Catalog Number | I019813 |
| CAS Number | 1011244-68-0 |
| Molecular Formula | C₁₃H₁₀F₃N₃O |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| IUPAC Name | N-(5-aminopyridin-2-yl)-4-(trifluoromethyl)benzamide |
| InChI | 1S/C13H10F3N3O/c14-13(15,16)9-3-1-8(2-4-9)12(20)19-11-6-5-10(17)7-18-11/h1-7H,17H2,(H,18,19,20) |
| InChIKey | BTCFFMPDIBWZLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=NC=C(C=C2)N)C(F)(F)F |
