For research use only. Not for therapeutic Use.
TG100713(cas# 925705-73-3) is an inhibitor of PI3-kinase (IC50 values are 24, 50, 165 and 215 nM for PI3Kδ, γ, α and β isoforms respectively). Inhibits endothelial cell proliferation.
| Catalog Number | R057467 |
| CAS Number | 925705-73-3 |
| Synonyms | TG 100713;TG-100713;TG100713;3-(2,4-Diamino-6-pteridinyl)phenol; |
| Molecular Formula | C12H10N6O |
| Purity | ≥95% |
| Target | PI3K |
| Solubility | Limited solubility |
| Storage | <label class= |
| IUPAC Name | 3-(2,4-diaminopteridin-6-yl)phenol |
| InChI | InChI=1S/C12H10N6O/c13-10-9-11(18-12(14)17-10)15-5-8(16-9)6-2-1-3-7(19)4-6/h1-5,19H,(H4,13,14,15,17,18) |
| InChIKey | UOORQSPLBHUQDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=CN=C3C(=N2)C(=NC(=N3)N)N |
| Reference | <br /> |
