For research use only. Not for therapeutic Use.
TH10785（Cat No.:I043386）is a small-molecule inhibitor targeting the protein kinase R-like endoplasmic reticulum kinase (PERK), an enzyme involved in the unfolded protein response (UPR). By inhibiting PERK, TH10785 helps to disrupt the stress response in cancer cells, making them more susceptible to apoptosis. This mechanism is particularly useful in treating cancers that rely on stress-induced survival pathways. Preclinical studies suggest that TH10785 may enhance the effectiveness of other cancer therapies, including chemotherapy and radiation. Ongoing research is focused on evaluating its safety, efficacy, and potential in combination cancer treatments.
| CAS Number | 1002801-51-5 |
| Synonyms | N-cyclohexyl-2-cyclopropylquinazolin-4-amine |
| Molecular Formula | C17H21N3 |
| Purity | ≥95% |
| IUPAC Name | N-cyclohexyl-2-cyclopropylquinazolin-4-amine |
| InChI | InChI=1S/C17H21N3/c1-2-6-13(7-3-1)18-17-14-8-4-5-9-15(14)19-16(20-17)12-10-11-12/h4-5,8-9,12-13H,1-3,6-7,10-11H2,(H,18,19,20) |
| InChIKey | ZQMGQZOHIDOPCQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=NC(=NC3=CC=CC=C32)C4CC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
