For research use only. Not for therapeutic Use.
Thalidomide-O-amido-C6-NH2 hydrochloride, a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker, can be used in the synthesis of PROTACs[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Catalog Number | I015417 |
| CAS Number | 2376990-31-5 |
| Synonyms | N-(6-aminohexyl)-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetamide;hydrochloride |
| Molecular Formula | C21H27ClN4O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H26N4O6.ClH/c22-10-3-1-2-4-11-23-17(27)12-31-15-7-5-6-13-18(15)21(30)25(20(13)29)14-8-9-16(26)24-19(14)28;/h5-7,14H,1-4,8-12,22H2,(H,23,27)(H,24,26,28);1H |
| InChIKey | AKGOZIANMTYDFK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCC(=O)NCCCCCCN.Cl |
| Reference | [1]. Bradner J, et al. Targeted protein degradation to attenuate adoptive t-cell therapy associated adverse inflammatory responses. WO 2017024318 A1 |
