For research use only. Not for therapeutic Use.
Thapsigargin is a potent, non-competitive inhibitor of the sarco/endoplasmic reticulum Ca²⁺-ATPase (SERCA), widely used in cellular and biochemical research. By disrupting calcium homeostasis, it induces endoplasmic reticulum stress, triggering apoptosis in various cell types. Thapsigargin is a valuable tool for studying calcium signaling, cell death pathways, and cancer biology. Additionally, it has shown potential as a prodrug in targeted cancer therapies. Extracted from Thapsia garganica, it continues to play a critical role in advancing calcium-dependent physiological and pathological research.
| Catalog Number | R053589 |
| CAS Number | 67526-95-8 |
| Synonyms | Octanoic Acid (3S,3aR,4S,6S,6aR,7S,8S,9bS)-6-(Acetyloxy)-2,3,3a,4,5,6,6a,7,8,9b- decahydro-3,3a-dihydroxy-3,6,9-trimethyl-8-[[(2Z)-2-methyl-1-oxo-2-butenyl]oxy]-2-oxo-4-(1-oxobutoxy)azuleno[4,5-b]furan-7-yl Ester; (-)-Thapsigargin; Octanoic Acid [3S- |
| Molecular Formula | C₃₄H₅₀O₁₂ |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO or 100% ethanol. |
| Storage | Desiccate at -20℃ |
| IUPAC Name | [(3S,3aR,4S,6S,6aR,7S,8S,9bS)-6-acetyloxy-4-butanoyloxy-3,3a-dihydroxy-3,6,9-trimethyl-8-[(Z)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] octanoate |
| InChI | InChI=1S/C34H50O12/c1-9-12-13-14-15-17-24(37)43-28-26-25(20(5)27(28)44-30(38)19(4)11-3)29-34(41,33(8,40)31(39)45-29)22(42-23(36)16-10-2)18-32(26,7)46-21(6)35/h11,22,26-29,40-41H,9-10,12-18H2,1-8H3/b19-11-/t22-,26+,27-,28-,29-,32-,33+,34+/m0/s1 |
| InChIKey | IXFPJGBNCFXKPI-FSIHEZPISA-N |
| SMILES | CCCCCCCC(=O)OC1C2C(=C(C1OC(=O)C(=CC)C)C)C3C(C(CC2(C)OC(=O)C)OC(=O)CCC)(C(C(=O)O3)(C)O)O |
