For research use only. Not for therapeutic Use.
Theaflavin（Cat No.:I000044）is a polyphenolic compound found in black tea, known for its potent antioxidant, anti-inflammatory, and antimicrobial properties. Derived from catechins during tea fermentation, it contributes to the distinct flavor and health benefits of black tea. Theaflavin has been studied for its potential to support cardiovascular health, regulate blood glucose levels, and protect against oxidative stress. Additionally, its anti-cancer properties have gained interest, as it may inhibit tumor cell growth and promote apoptosis. As a natural bioactive compound, theaflavin holds promise in nutraceutical and therapeutic research.
| Catalog Number | I000044 |
| CAS Number | 4670-05-7 |
| Molecular Formula | C29H24O12 |
| Purity | ≥95% |
| Target | Influenza A (H1N1) virus [1] |
| Solubility | 10 mM in H2O |
| Storage | -20°C |
| IUPAC Name | 3,4,6-trihydroxy-1,8-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]benzo[7]annulen-5-one |
| InChI | InChI=1S/C29H24O12/c30-11-3-17(32)15-8-21(36)28(40-23(15)5-11)10-1-13-14(7-20(35)27(39)25(13)26(38)19(34)2-10)29-22(37)9-16-18(33)4-12(31)6-24(16)41-29/h1-7,21-22,28-33,35-37,39H,8-9H2,(H,34,38)/t21-,22-,28-,29-/m1/s1 |
| InChIKey | IPMYMEWFZKHGAX-ZKSIBHASSA-N |
| SMILES | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC4=C(C(=C(C=C4[C@@H]5[C@@H](CC6=C(C=C(C=C6O5)O)O)O)O)O)C(=O)C(=C3)O)O |
| Reference | <p style=/line-height:25px/> </p> |
