For research use only. Not for therapeutic Use.
Theobromine-d6(Cat No.:S000365) is a deuterated version of theobromine, where six hydrogen atoms are replaced with deuterium. Theobromine is a natural compound found in cocoa beans and chocolate, known for its mild stimulant effects similar to caffeine. By incorporating deuterium, scientists can explore theobromine’s metabolic pathways and its pharmacokinetics with greater precision. This isotope labeling allows for accurate tracing of theobromine in biological systems, aiding studies on its bioavailability, metabolism, and potential therapeutic applications, such as its role in mood enhancement and cardiovascular health.
CAS Number | 117490-40-1 |
Molecular Formula | C7H2D6N4O2 |
Purity | ≥95% |
IUPAC Name | 3,7-bis(trideuteriomethyl)purine-2,6-dione |
InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13)/i1D3,2D3 |
InChIKey | YAPQBXQYLJRXSA-WFGJKAKNSA-N |
SMILES | CN1C=NC2=C1C(=O)NC(=O)N2C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |