For research use only. Not for therapeutic Use.
Theodrenaline hydrochloride(CAT: I040741) is a synthetic compound combining the pharmacological properties of theophylline, a bronchodilator and adenosine receptor antagonist, with noradrenaline, a potent adrenergic agonist. This dual-acting molecule exhibits both bronchodilatory and cardiostimulant effects, making it useful in research on cardiovascular and respiratory physiology. Theodrenaline hydrochloride enhances cardiac output, increases blood pressure, and supports respiratory function, and is often studied for its synergistic action on β-adrenergic and phosphodiesterase-inhibiting pathways.
| CAS Number | 2572-61-4 |
| Synonyms | 7-[2-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
| Molecular Formula | C17H22ClN5O5 |
| Purity | ≥95% |
| IUPAC Name | 7-[2-[[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]amino]ethyl]-1,3-dimethylpurine-2,6-dione;hydrochloride |
| InChI | InChI=1S/C17H21N5O5.ClH/c1-20-15-14(16(26)21(2)17(20)27)22(9-19-15)6-5-18-8-13(25)10-3-4-11(23)12(24)7-10;/h3-4,7,9,13,18,23-25H,5-6,8H2,1-2H3;1H |
| InChIKey | CSKCJAUXLOQTMM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCNCC(C3=CC(=C(C=C3)O)O)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
